Publication | Closed Access
Synthesis and Crystal Structure Determination of Some Asymmetrical and Symmetrical CR-Type Macrocyclic Schiff Base Complexes, with a Single Pendant Coordinating 2-Aminoethyl Arm
65
Citations
17
References
2000
Year
Inorganic ChemistryEngineeringCoordination Complex-Tetraamine LigandCrystal Structure DeterminationMolecular ComplexChemistryAsymmetrical Tripodal 2,3',4CrystallographyPrimary Amino GroupInorganic SynthesisBiomolecular EngineeringInorganic Compound
A novel, totally asymmetrical tripodal 2,3',4"-tetraamine ligand, N((CH2)2NH2)((CH2)3NH2)((CH2)4NH2), epb, has been synthesized. In the presence of copper(II) and nickel(II) ions it condenses with 2,6-diacetylpyridine in 1:1 ethanol-water solution, producing some new CR-type complexes with a pendant primary amino group. The X-ray crystal structure of the resulting copper(II) complex, [Cu(3,4(2)-CR)](PF6)2 (1), and two other related complexes, [Cu(2,4(2)-CR)](ClO4)2 (2) and [Cu(3,3(2)-CR)](ClO4)2 (3), are reported. Crystal data: complex 1, monoclinic, P2(1)/n, a = 8.366(3) A, b = 15.549(3) A, c = 20.283(2) A, beta = 98.73(2) degrees, V = 2607.8(11) A3, Z = 4, R1 = 0.0621, wR2 = 0.1615; complex 2, monoclinic, P2(1)/c, a = 7.981(10) A, b = 18.882(3) A, c = 15.185(3) A, beta = 96.40(2) degrees, V = 2275.7(6) A3, Z = 4, R1 = 0.0773, wR2 = 0.1635; complex 3, monoclinic, P2(1)/n, a = 7.8764(10) A, b = 15.361(2) A, c = 19.370(2) A, beta = 100.330(10) degrees, V = 2305.7(5) A3, Z = 4, R1 = 0.0537, wR2 = 0.1397. In all of these, copper atoms are bonded to four nitrogens of a macrocyclic ring and a nitrogen of the pendant arm. The arrangements are slightly distorted square-pyramidal in which the primary amino groups occupy apical positions and have the longest Cu-N distances. For all isomers, copper(II) ions are somewhat above the plane of the imino-pyridine system of the macrocylic ring in the direction of the pendant coordinated primary amino group.
| Year | Citations | |
|---|---|---|
Page 1
Page 1