Amino Acid Templating of Inorganic Networks: Synthesis and Structure of <scp>l</scp>-Asparagine Zinc Phosphite, C₄N₂O₃H₈·ZnHPO₃

Abstract

C(4)N(2)O(3)H(8).ZnHPO(3) is the first zincophosphite framework to be templated by an amino acid (l-asparagine), which bonds to Zn via a carboxyl O atom. It contains infinite, homochiral, helical 4-ring chains of ZnO(4) and HPO(3) groups, stabilized by intra- and interchain N-H.O hydrogen bonds. Crystal data: C(4)N(2)O(3)H(8).ZnHPO(3), M(r) = 277.49, orthorhombic, P2(1)2(1)2(1) (No. 19), a = 5.0349(2) A, b = 9.4539(4) A, c = 18.6092(8) A, V = 885.79 (6) A(3), Z = 4.