Publication | Closed Access
Novel Six-Coordinate Oxorhenium “3 + 2” Mixed-Ligand Complexes Carrying the SNS/PO Donor Atom Set: Synthesis and Characterization
38
Citations
19
References
1999
Year
Replacing the monothiolate group of the so-called “3 + 1” mixed-ligand oxorhenium(V) complexes with the bidentate phosphinophenolate ligand produces novel “3 + 2” mixed-ligand complexes carrying the SNS/PO donor atom set. Thus, reactions of either [ReOCl3(L)]- or [ReOCl2(L)(PPh3)] (HL = o-HOC6H4P(C6H5)2) with aminedithiol (H2Ln) in dichloromethane methanol solutions lead to six-coordinate mixed-ligand oxo−Re(V) complexes of the type [ReO(Ln)(L)], where H2L1 = CH3CH2N(CH2CH2SH)2 (1), H2L2 = (CH3CH2)2NCH2CH2N(CH2CH2SH)2 (2), and H2L3 = CH3CH2SCH2CH2N(CH2CH2SH)2 (3). The coordination geometry around rhenium is distorted octahedral with the SNS donors of the aminedithiolate and the phosphorus of the phosphinophenolate ligand defining the equatorial plane, while the apical positions are occupied by the oxo group and the oxygen atom of the HL ligand, as shown by single-crystal X-ray analyses of 1 and 3. The strong metal−phosphorus bonds together with the chelating properties of both ligands contribute to the stability of 18-electron [ReO(Ln)(L)] complexes. In fact, these six-coordinate species appear to be much more substitution inert than the “3 + 1” analogous complexes vs excess thiolate, such as cysteine or glutathione, during appropriate challenge reactions.
| Year | Citations | |
|---|---|---|
Page 1
Page 1